C12H14Cl2N2O3 — CID 64896143
3-amino-4-[1-(3,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid (PubChem CID 64896143) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 3-amino-4-[1-(3,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[1-(3,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64896143 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 3-amino-4-[1-(3,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid |
| SMILES | CC(NC(=O)C(N)CC(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O3/c1-6(7-2-3-8(13)9(14)4-7)16-12(19)10(15)5-11(17)18/h2-4,6,10H,5,15H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | IDSIFGSFFAZSBR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |