C13H18Cl2N2O3S — CID 61249265
2-amino-N-[1-(3,4-dichlorophenyl)ethyl]-4-methylsulfonylbutanamide (PubChem CID 61249265) has the molecular formula C13H18Cl2N2O3S and a molecular weight of 353.27 g/mol. Its IUPAC name is 2-amino-N-[1-(3,4-dichlorophenyl)ethyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[1-(3,4-dichlorophenyl)ethyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 61249265 |
| Molecular Formula | C13H18Cl2N2O3S |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 2-amino-N-[1-(3,4-dichlorophenyl)ethyl]-4-methylsulfonylbutanamide |
| SMILES | CC(NC(=O)C(N)CCS(C)(=O)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O3S/c1-8(9-3-4-10(14)11(15)7-9)17-13(18)12(16)5-6-21(2,19)20/h3-4,7-8,12H,5-6,16H2,1-2H3,(H,17,18) |
| InChIKey | KGFWSBQMXVRVJD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |