C11H13Cl3N2O3S — CID 43097188
2-amino-4-methylsulfonyl-N-(2,4,5-trichlorophenyl)butanamide (PubChem CID 43097188) has the molecular formula C11H13Cl3N2O3S and a molecular weight of 359.66 g/mol. Its IUPAC name is 2-amino-4-methylsulfonyl-N-(2,4,5-trichlorophenyl)butanamide.
| Compound Name | 2-amino-4-methylsulfonyl-N-(2,4,5-trichlorophenyl)butanamide |
|---|---|
| PubChem CID | 43097188 |
| Molecular Formula | C11H13Cl3N2O3S |
| Molecular Weight | 359.66 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 2-amino-4-methylsulfonyl-N-(2,4,5-trichlorophenyl)butanamide |
| SMILES | CS(=O)(=O)CCC(N)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl3N2O3S/c1-20(18,19)3-2-9(15)11(17)16-10-5-7(13)6(12)4-8(10)14/h4-5,9H,2-3,15H2,1H3,(H,16,17) |
| InChIKey | CQGADRYZNDQUEO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|