C11H14Cl2N2O3S — CID 43094521
2-amino-N-(3,5-dichlorophenyl)-4-methylsulfonylbutanamide (PubChem CID 43094521) has the molecular formula C11H14Cl2N2O3S and a molecular weight of 325.22 g/mol. Its IUPAC name is 2-amino-N-(3,5-dichlorophenyl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(3,5-dichlorophenyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 43094521 |
| Molecular Formula | C11H14Cl2N2O3S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 2-amino-N-(3,5-dichlorophenyl)-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(N)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O3S/c1-19(17,18)3-2-10(14)11(16)15-9-5-7(12)4-8(13)6-9/h4-6,10H,2-3,14H2,1H3,(H,15,16) |
| InChIKey | HLZLOQFISQLMAE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |