C15H23ClN2O4S — CID 119956470
2-amino-N-[3-chloro-4-(2-methylpropoxy)phenyl]-4-methylsulfonylbutanamide (PubChem CID 119956470) has the molecular formula C15H23ClN2O4S and a molecular weight of 362.88 g/mol. Its IUPAC name is 2-amino-N-[3-chloro-4-(2-methylpropoxy)phenyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[3-chloro-4-(2-methylpropoxy)phenyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 119956470 |
| Molecular Formula | C15H23ClN2O4S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 2-amino-N-[3-chloro-4-(2-methylpropoxy)phenyl]-4-methylsulfonylbutanamide |
| SMILES | CC(C)COc1ccc(NC(=O)C(N)CCS(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C15H23ClN2O4S/c1-10(2)9-22-14-5-4-11(8-12(14)16)18-15(19)13(17)6-7-23(3,20)21/h4-5,8,10,13H,6-7,9,17H2,1-3H3,(H,18,19) |
| InChIKey | PZUVENRQLJHMEV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |