C14H22N2O4S — CID 81368689
2-amino-N-[(1S)-1-(4-methoxyphenyl)ethyl]-4-methylsulfonylbutanamide (PubChem CID 81368689) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-amino-N-[(1S)-1-(4-methoxyphenyl)ethyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[(1S)-1-(4-methoxyphenyl)ethyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 81368689 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-amino-N-[(1S)-1-(4-methoxyphenyl)ethyl]-4-methylsulfonylbutanamide |
| SMILES | COc1ccc([C@H](C)NC(=O)C(N)CCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H22N2O4S/c1-10(11-4-6-12(20-2)7-5-11)16-14(17)13(15)8-9-21(3,18)19/h4-7,10,13H,8-9,15H2,1-3H3,(H,16,17)/t10-,13?/m0/s1 |
| InChIKey | JPKADQVIODBJDF-NKUHCKNESA-N |
| XLogP | 0.63 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |