C13H15Cl2NO3 — CID 119187880
2-[2-(3,4-dichlorophenyl)propanoylamino]-2-methylpropanoic acid (PubChem CID 119187880) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)propanoylamino]-2-methylpropanoic acid.
| Compound Name | 2-[2-(3,4-dichlorophenyl)propanoylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119187880 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)propanoylamino]-2-methylpropanoic acid |
| SMILES | CC(C(=O)NC(C)(C)C(=O)O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO3/c1-7(8-4-5-9(14)10(15)6-8)11(17)16-13(2,3)12(18)19/h4-7H,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | BDTSQIMEWBUPBT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |