C12H14Cl3NO — CID 55047578
N-tert-butyl-2-chloro-2-(3,4-dichlorophenyl)acetamide (PubChem CID 55047578) has the molecular formula C12H14Cl3NO and a molecular weight of 294.61 g/mol. Its IUPAC name is N-tert-butyl-2-chloro-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-tert-butyl-2-chloro-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 55047578 |
| Molecular Formula | C12H14Cl3NO |
| Molecular Weight | 294.61 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | N-tert-butyl-2-chloro-2-(3,4-dichlorophenyl)acetamide |
| SMILES | CC(C)(C)NC(=O)C(Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl3NO/c1-12(2,3)16-11(17)10(15)7-4-5-8(13)9(14)6-7/h4-6,10H,1-3H3,(H,16,17) |
| InChIKey | YLKLMSZKLIAABQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|