C12H17Cl4N — CID 14820786
N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylpropan-2-amine;hydrochloride (PubChem CID 14820786) has the molecular formula C12H17Cl4N and a molecular weight of 317.09 g/mol. Its IUPAC name is N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylpropan-2-amine;hydrochloride.
| Compound Name | N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 14820786 |
| Molecular Formula | C12H17Cl4N |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | N-[2-chloro-2-(3,4-dichlorophenyl)ethyl]-2-methylpropan-2-amine;hydrochloride |
| SMILES | CC(C)(C)NCC(Cl)c1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C12H16Cl3N.ClH/c1-12(2,3)16-7-11(15)8-4-5-9(13)10(14)6-8;/h4-6,11,16H,7H2,1-3H3;1H |
| InChIKey | WRGBGPBNQIMAGZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|