C10H11Cl3O — CID 82366996
4-chloro-4-(3,4-dichlorophenyl)butan-1-ol (PubChem CID 82366996) has the molecular formula C10H11Cl3O and a molecular weight of 253.56 g/mol. Its IUPAC name is 4-chloro-4-(3,4-dichlorophenyl)butan-1-ol.
| Compound Name | 4-chloro-4-(3,4-dichlorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 82366996 |
| Molecular Formula | C10H11Cl3O |
| Molecular Weight | 253.56 g/mol |
| Exact Mass | 251.99 |
| IUPAC Name | 4-chloro-4-(3,4-dichlorophenyl)butan-1-ol |
| SMILES | OCCCC(Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl3O/c11-8(2-1-5-14)7-3-4-9(12)10(13)6-7/h3-4,6,8,14H,1-2,5H2 |
| InChIKey | UTGZVNNEXYKWOG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|