C11H11Cl3F2O — CID 103210698
1,2-dichloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]benzene (PubChem CID 103210698) has the molecular formula C11H11Cl3F2O and a molecular weight of 303.56 g/mol. Its IUPAC name is 1,2-dichloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]benzene.
| Compound Name | 1,2-dichloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]benzene |
|---|---|
| PubChem CID | 103210698 |
| Molecular Formula | C11H11Cl3F2O |
| Molecular Weight | 303.56 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 1,2-dichloro-4-[1-chloro-3-(2,2-difluoroethoxy)propyl]benzene |
| SMILES | FC(F)COCCC(Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl3F2O/c12-8(3-4-17-6-11(15)16)7-1-2-9(13)10(14)5-7/h1-2,5,8,11H,3-4,6H2 |
| InChIKey | HLMHWCWEQXLMRN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|