C11H14BrF2NO — CID 103207036
1-(4-bromophenyl)-3-(2,2-difluoroethoxy)propan-1-amine (PubChem CID 103207036) has the molecular formula C11H14BrF2NO and a molecular weight of 294.14 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(2,2-difluoroethoxy)propan-1-amine.
| Compound Name | 1-(4-bromophenyl)-3-(2,2-difluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103207036 |
| Molecular Formula | C11H14BrF2NO |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 1-(4-bromophenyl)-3-(2,2-difluoroethoxy)propan-1-amine |
| SMILES | NC(CCOCC(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H14BrF2NO/c12-9-3-1-8(2-4-9)10(15)5-6-16-7-11(13)14/h1-4,10-11H,5-7,15H2 |
| InChIKey | KWHCUHBAVWVEDB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|