C15H21BrF2O3 — CID 103210882
4-[1-bromo-3-(2,2-difluoroethoxy)propyl]-1,2-diethoxybenzene (PubChem CID 103210882) has the molecular formula C15H21BrF2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is 4-[1-bromo-3-(2,2-difluoroethoxy)propyl]-1,2-diethoxybenzene.
| Compound Name | 4-[1-bromo-3-(2,2-difluoroethoxy)propyl]-1,2-diethoxybenzene |
|---|---|
| PubChem CID | 103210882 |
| Molecular Formula | C15H21BrF2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 4-[1-bromo-3-(2,2-difluoroethoxy)propyl]-1,2-diethoxybenzene |
| SMILES | CCOc1ccc(C(Br)CCOCC(F)F)cc1OCC |
| InChI | InChI=1S/C15H21BrF2O3/c1-3-20-13-6-5-11(9-14(13)21-4-2)12(16)7-8-19-10-15(17)18/h5-6,9,12,15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | MMBKJRHFXZGPDR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|