C12H13Br2F3O2 — CID 103396429
1-bromo-5-[1-bromo-3-(2,2-difluoroethoxy)propyl]-2-fluoro-4-methoxybenzene (PubChem CID 103396429) has the molecular formula C12H13Br2F3O2 and a molecular weight of 406.04 g/mol. Its IUPAC name is 1-bromo-5-[1-bromo-3-(2,2-difluoroethoxy)propyl]-2-fluoro-4-methoxybenzene.
| Compound Name | 1-bromo-5-[1-bromo-3-(2,2-difluoroethoxy)propyl]-2-fluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 103396429 |
| Molecular Formula | C12H13Br2F3O2 |
| Molecular Weight | 406.04 g/mol |
| Exact Mass | 403.92 |
| IUPAC Name | 1-bromo-5-[1-bromo-3-(2,2-difluoroethoxy)propyl]-2-fluoro-4-methoxybenzene |
| SMILES | COc1cc(F)c(Br)cc1C(Br)CCOCC(F)F |
| InChI | InChI=1S/C12H13Br2F3O2/c1-18-11-5-10(15)9(14)4-7(11)8(13)2-3-19-6-12(16)17/h4-5,8,12H,2-3,6H2,1H3 |
| InChIKey | JYKDZCXFKLWFJX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.04 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|