C10H7BrClF5O — CID 103396376
1-bromo-5-(1-chloro-2,2,3,3-tetrafluoropropyl)-2-fluoro-4-methoxybenzene (PubChem CID 103396376) has the molecular formula C10H7BrClF5O and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-bromo-5-(1-chloro-2,2,3,3-tetrafluoropropyl)-2-fluoro-4-methoxybenzene.
| Compound Name | 1-bromo-5-(1-chloro-2,2,3,3-tetrafluoropropyl)-2-fluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 103396376 |
| Molecular Formula | C10H7BrClF5O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | 1-bromo-5-(1-chloro-2,2,3,3-tetrafluoropropyl)-2-fluoro-4-methoxybenzene |
| SMILES | COc1cc(F)c(Br)cc1C(Cl)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H7BrClF5O/c1-18-7-3-6(13)5(11)2-4(7)8(12)10(16,17)9(14)15/h2-3,8-9H,1H3 |
| InChIKey | DMSOKVQUMWDOFF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|