C11H10BrF6NO — CID 103394560
1-(5-bromo-4-fluoro-2-methoxyphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine (PubChem CID 103394560) has the molecular formula C11H10BrF6NO and a molecular weight of 366.10 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2-methoxyphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine.
| Compound Name | 1-(5-bromo-4-fluoro-2-methoxyphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 103394560 |
| Molecular Formula | C11H10BrF6NO |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2-methoxyphenyl)-2,2,3,3,3-pentafluoro-N-methylpropan-1-amine |
| SMILES | CNC(c1cc(Br)c(F)cc1OC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10BrF6NO/c1-19-9(10(14,15)11(16,17)18)5-3-6(12)7(13)4-8(5)20-2/h3-4,9,19H,1-2H3 |
| InChIKey | OMLDFPYMPJKRPG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|