C17H19BrFNO — CID 103394612
1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(2-ethylphenyl)-N-methylmethanamine (PubChem CID 103394612) has the molecular formula C17H19BrFNO and a molecular weight of 352.25 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(2-ethylphenyl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(2-ethylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 103394612 |
| Molecular Formula | C17H19BrFNO |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(2-ethylphenyl)-N-methylmethanamine |
| SMILES | CCc1ccccc1C(NC)c1cc(Br)c(F)cc1OC |
| InChI | InChI=1S/C17H19BrFNO/c1-4-11-7-5-6-8-12(11)17(20-2)13-9-14(18)15(19)10-16(13)21-3/h5-10,17,20H,4H2,1-3H3 |
| InChIKey | CVBBAHMABUJHNX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |