C15H13Br2ClFNO — CID 107951008
1-(3-bromo-5-chlorophenyl)-1-(5-bromo-4-fluoro-2-methoxyphenyl)-N-methylmethanamine (PubChem CID 107951008) has the molecular formula C15H13Br2ClFNO and a molecular weight of 437.53 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-1-(5-bromo-4-fluoro-2-methoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-1-(5-bromo-4-fluoro-2-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107951008 |
| Molecular Formula | C15H13Br2ClFNO |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 434.90 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-1-(5-bromo-4-fluoro-2-methoxyphenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(Cl)cc(Br)c1)c1cc(Br)c(F)cc1OC |
| InChI | InChI=1S/C15H13Br2ClFNO/c1-20-15(8-3-9(16)5-10(18)4-8)11-6-12(17)13(19)7-14(11)21-2/h3-7,15,20H,1-2H3 |
| InChIKey | OOYDAICAWIFTPU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |