C13H12BrFINOS — CID 103394542
1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine (PubChem CID 103394542) has the molecular formula C13H12BrFINOS and a molecular weight of 456.12 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 103394542 |
| Molecular Formula | C13H12BrFINOS |
| Molecular Weight | 456.12 g/mol |
| Exact Mass | 454.89 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine |
| SMILES | CNC(c1csc(I)c1)c1cc(Br)c(F)cc1OC |
| InChI | InChI=1S/C13H12BrFINOS/c1-17-13(7-3-12(16)19-6-7)8-4-9(14)10(15)5-11(8)18-2/h3-6,13,17H,1-2H3 |
| InChIKey | MXOAEMYRUGTNBT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.12 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|