C13H12Br2FNO2 — CID 103394584
1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(5-bromofuran-2-yl)-N-methylmethanamine (PubChem CID 103394584) has the molecular formula C13H12Br2FNO2 and a molecular weight of 393.05 g/mol. Its IUPAC name is 1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(5-bromofuran-2-yl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(5-bromofuran-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 103394584 |
| Molecular Formula | C13H12Br2FNO2 |
| Molecular Weight | 393.05 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | 1-(5-bromo-4-fluoro-2-methoxyphenyl)-1-(5-bromofuran-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(Br)o1)c1cc(Br)c(F)cc1OC |
| InChI | InChI=1S/C13H12Br2FNO2/c1-17-13(10-3-4-12(15)19-10)7-5-8(14)9(16)6-11(7)18-2/h3-6,13,17H,1-2H3 |
| InChIKey | CXFBOLNBEMUYKK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.05 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |