C13H11BrFIO2S — CID 79684071
4-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]-2-iodothiophene (PubChem CID 79684071) has the molecular formula C13H11BrFIO2S and a molecular weight of 457.10 g/mol. Its IUPAC name is 4-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]-2-iodothiophene.
| Compound Name | 4-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]-2-iodothiophene |
|---|---|
| PubChem CID | 79684071 |
| Molecular Formula | C13H11BrFIO2S |
| Molecular Weight | 457.10 g/mol |
| Exact Mass | 455.87 |
| IUPAC Name | 4-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]-2-iodothiophene |
| SMILES | COc1cc(F)c(C(Br)c2csc(I)c2)cc1OC |
| InChI | InChI=1S/C13H11BrFIO2S/c1-17-10-4-8(9(15)5-11(10)18-2)13(14)7-3-12(16)19-6-7/h3-6,13H,1-2H3 |
| InChIKey | KQEUVUIEYRHALR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.10 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|