C14H14BrFO2S — CID 55125430
2-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]-5-methylthiophene (PubChem CID 55125430) has the molecular formula C14H14BrFO2S and a molecular weight of 345.23 g/mol. Its IUPAC name is 2-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]-5-methylthiophene.
| Compound Name | 2-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]-5-methylthiophene |
|---|---|
| PubChem CID | 55125430 |
| Molecular Formula | C14H14BrFO2S |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 2-[bromo-(2-fluoro-4,5-dimethoxyphenyl)methyl]-5-methylthiophene |
| SMILES | COc1cc(F)c(C(Br)c2ccc(C)s2)cc1OC |
| InChI | InChI=1S/C14H14BrFO2S/c1-8-4-5-13(19-8)14(15)9-6-11(17-2)12(18-3)7-10(9)16/h4-7,14H,1-3H3 |
| InChIKey | QUXCHWNGCMVALA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|