C15H17BrO3S — CID 61096894
2-[bromo-(2,4,6-trimethoxyphenyl)methyl]-5-methylthiophene (PubChem CID 61096894) has the molecular formula C15H17BrO3S and a molecular weight of 357.27 g/mol. Its IUPAC name is 2-[bromo-(2,4,6-trimethoxyphenyl)methyl]-5-methylthiophene.
| Compound Name | 2-[bromo-(2,4,6-trimethoxyphenyl)methyl]-5-methylthiophene |
|---|---|
| PubChem CID | 61096894 |
| Molecular Formula | C15H17BrO3S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 2-[bromo-(2,4,6-trimethoxyphenyl)methyl]-5-methylthiophene |
| SMILES | COc1cc(OC)c(C(Br)c2ccc(C)s2)c(OC)c1 |
| InChI | InChI=1S/C15H17BrO3S/c1-9-5-6-13(20-9)15(16)14-11(18-3)7-10(17-2)8-12(14)19-4/h5-8,15H,1-4H3 |
| InChIKey | WHNNGVYJAATPPG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|