C16H16Br2O3 — CID 63438924
2-[bromo-(3-bromophenyl)methyl]-1,3,5-trimethoxybenzene (PubChem CID 63438924) has the molecular formula C16H16Br2O3 and a molecular weight of 416.11 g/mol. Its IUPAC name is 2-[bromo-(3-bromophenyl)methyl]-1,3,5-trimethoxybenzene.
| Compound Name | 2-[bromo-(3-bromophenyl)methyl]-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 63438924 |
| Molecular Formula | C16H16Br2O3 |
| Molecular Weight | 416.11 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 2-[bromo-(3-bromophenyl)methyl]-1,3,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(C(Br)c2cccc(Br)c2)c(OC)c1 |
| InChI | InChI=1S/C16H16Br2O3/c1-19-12-8-13(20-2)15(14(9-12)21-3)16(18)10-5-4-6-11(17)7-10/h4-9,16H,1-3H3 |
| InChIKey | RPZITBDSBGNRCO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.11 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|