C12H8BrF3S — CID 79755175
2-[bromo-(2,3,4-trifluorophenyl)methyl]-5-methylthiophene (PubChem CID 79755175) has the molecular formula C12H8BrF3S and a molecular weight of 321.16 g/mol. Its IUPAC name is 2-[bromo-(2,3,4-trifluorophenyl)methyl]-5-methylthiophene.
| Compound Name | 2-[bromo-(2,3,4-trifluorophenyl)methyl]-5-methylthiophene |
|---|---|
| PubChem CID | 79755175 |
| Molecular Formula | C12H8BrF3S |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | 2-[bromo-(2,3,4-trifluorophenyl)methyl]-5-methylthiophene |
| SMILES | Cc1ccc(C(Br)c2ccc(F)c(F)c2F)s1 |
| InChI | InChI=1S/C12H8BrF3S/c1-6-2-5-9(17-6)10(13)7-3-4-8(14)12(16)11(7)15/h2-5,10H,1H3 |
| InChIKey | GLOQFSMDGKPGOC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|