C12H7BrClF3S — CID 102765037
5-[bromo-(2,3,4-trifluorophenyl)methyl]-2-chloro-3-methylthiophene (PubChem CID 102765037) has the molecular formula C12H7BrClF3S and a molecular weight of 355.61 g/mol. Its IUPAC name is 5-[bromo-(2,3,4-trifluorophenyl)methyl]-2-chloro-3-methylthiophene.
| Compound Name | 5-[bromo-(2,3,4-trifluorophenyl)methyl]-2-chloro-3-methylthiophene |
|---|---|
| PubChem CID | 102765037 |
| Molecular Formula | C12H7BrClF3S |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 353.91 |
| IUPAC Name | 5-[bromo-(2,3,4-trifluorophenyl)methyl]-2-chloro-3-methylthiophene |
| SMILES | Cc1cc(C(Br)c2ccc(F)c(F)c2F)sc1Cl |
| InChI | InChI=1S/C12H7BrClF3S/c1-5-4-8(18-12(5)14)9(13)6-2-3-7(15)11(17)10(6)16/h2-4,9H,1H3 |
| InChIKey | PFSJXYJYULVVMP-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|