C11H4Br2ClF3S — CID 102836767
3-bromo-5-[bromo-(2,3,4-trifluorophenyl)methyl]-2-chlorothiophene (PubChem CID 102836767) has the molecular formula C11H4Br2ClF3S and a molecular weight of 420.48 g/mol. Its IUPAC name is 3-bromo-5-[bromo-(2,3,4-trifluorophenyl)methyl]-2-chlorothiophene.
| Compound Name | 3-bromo-5-[bromo-(2,3,4-trifluorophenyl)methyl]-2-chlorothiophene |
|---|---|
| PubChem CID | 102836767 |
| Molecular Formula | C11H4Br2ClF3S |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 417.80 |
| IUPAC Name | 3-bromo-5-[bromo-(2,3,4-trifluorophenyl)methyl]-2-chlorothiophene |
| SMILES | Fc1ccc(C(Br)c2cc(Br)c(Cl)s2)c(F)c1F |
| InChI | InChI=1S/C11H4Br2ClF3S/c12-5-3-7(18-11(5)14)8(13)4-1-2-6(15)10(17)9(4)16/h1-3,8H |
| InChIKey | FCCLXIDQBCBGSP-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|