C9H3Br4ClS2 — CID 102836981
2,3-dibromo-5-[bromo-(4-bromo-5-chlorothiophen-2-yl)methyl]thiophene (PubChem CID 102836981) has the molecular formula C9H3Br4ClS2 and a molecular weight of 530.33 g/mol. Its IUPAC name is 2,3-dibromo-5-[bromo-(4-bromo-5-chlorothiophen-2-yl)methyl]thiophene.
| Compound Name | 2,3-dibromo-5-[bromo-(4-bromo-5-chlorothiophen-2-yl)methyl]thiophene |
|---|---|
| PubChem CID | 102836981 |
| Molecular Formula | C9H3Br4ClS2 |
| Molecular Weight | 530.33 g/mol |
| Exact Mass | 525.61 |
| IUPAC Name | 2,3-dibromo-5-[bromo-(4-bromo-5-chlorothiophen-2-yl)methyl]thiophene |
| SMILES | Clc1sc(C(Br)c2cc(Br)c(Br)s2)cc1Br |
| InChI | InChI=1S/C9H3Br4ClS2/c10-3-1-5(15-8(3)13)7(12)6-2-4(11)9(14)16-6/h1-2,7H |
| InChIKey | QKSMWFWKLDEVOA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.33 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|