C9H4Br3ClOS — CID 106689189
2-[bromo-(4,5-dibromothiophen-2-yl)methyl]-5-chlorofuran (PubChem CID 106689189) has the molecular formula C9H4Br3ClOS and a molecular weight of 435.36 g/mol. Its IUPAC name is 2-[bromo-(4,5-dibromothiophen-2-yl)methyl]-5-chlorofuran.
| Compound Name | 2-[bromo-(4,5-dibromothiophen-2-yl)methyl]-5-chlorofuran |
|---|---|
| PubChem CID | 106689189 |
| Molecular Formula | C9H4Br3ClOS |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 431.72 |
| IUPAC Name | 2-[bromo-(4,5-dibromothiophen-2-yl)methyl]-5-chlorofuran |
| SMILES | Clc1ccc(C(Br)c2cc(Br)c(Br)s2)o1 |
| InChI | InChI=1S/C9H4Br3ClOS/c10-4-3-6(15-9(4)12)8(11)5-1-2-7(13)14-5/h1-3,8H |
| InChIKey | CFZQXFLEZZPCDS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|