C10H6Br4S2 — CID 80534570
2,3-dibromo-5-[bromo-(5-bromo-4-methylthiophen-2-yl)methyl]thiophene (PubChem CID 80534570) has the molecular formula C10H6Br4S2 and a molecular weight of 509.91 g/mol. Its IUPAC name is 2,3-dibromo-5-[bromo-(5-bromo-4-methylthiophen-2-yl)methyl]thiophene.
| Compound Name | 2,3-dibromo-5-[bromo-(5-bromo-4-methylthiophen-2-yl)methyl]thiophene |
|---|---|
| PubChem CID | 80534570 |
| Molecular Formula | C10H6Br4S2 |
| Molecular Weight | 509.91 g/mol |
| Exact Mass | 505.66 |
| IUPAC Name | 2,3-dibromo-5-[bromo-(5-bromo-4-methylthiophen-2-yl)methyl]thiophene |
| SMILES | Cc1cc(C(Br)c2cc(Br)c(Br)s2)sc1Br |
| InChI | InChI=1S/C10H6Br4S2/c1-4-2-6(15-9(4)13)8(12)7-3-5(11)10(14)16-7/h2-3,8H,1H3 |
| InChIKey | PDQOSPNTNFXIRF-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.91 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|