C16H11Br3S — CID 81432825
2,3-dibromo-5-[bromo-(2-methylnaphthalen-1-yl)methyl]thiophene (PubChem CID 81432825) has the molecular formula C16H11Br3S and a molecular weight of 475.04 g/mol. Its IUPAC name is 2,3-dibromo-5-[bromo-(2-methylnaphthalen-1-yl)methyl]thiophene.
| Compound Name | 2,3-dibromo-5-[bromo-(2-methylnaphthalen-1-yl)methyl]thiophene |
|---|---|
| PubChem CID | 81432825 |
| Molecular Formula | C16H11Br3S |
| Molecular Weight | 475.04 g/mol |
| Exact Mass | 471.81 |
| IUPAC Name | 2,3-dibromo-5-[bromo-(2-methylnaphthalen-1-yl)methyl]thiophene |
| SMILES | Cc1ccc2ccccc2c1C(Br)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C16H11Br3S/c1-9-6-7-10-4-2-3-5-11(10)14(9)15(18)13-8-12(17)16(19)20-13/h2-8,15H,1H3 |
| InChIKey | WXWYFEPVPAKTTC-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.04 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|