C16H13Br2NS — CID 80536710
1-(4,5-dibromothiophen-2-yl)-2-naphthalen-1-ylethanamine (PubChem CID 80536710) has the molecular formula C16H13Br2NS and a molecular weight of 411.16 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-2-naphthalen-1-ylethanamine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-2-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 80536710 |
| Molecular Formula | C16H13Br2NS |
| Molecular Weight | 411.16 g/mol |
| Exact Mass | 408.91 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-2-naphthalen-1-ylethanamine |
| SMILES | NC(Cc1cccc2ccccc12)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C16H13Br2NS/c17-13-9-15(20-16(13)18)14(19)8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7,9,14H,8,19H2 |
| InChIKey | VLFQTSSSEHHFHL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.16 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |