C17H16BrNS — CID 105139176
1-(4-bromothiophen-2-yl)-3-naphthalen-1-ylpropan-2-amine (PubChem CID 105139176) has the molecular formula C17H16BrNS and a molecular weight of 346.29 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-3-naphthalen-1-ylpropan-2-amine.
| Compound Name | 1-(4-bromothiophen-2-yl)-3-naphthalen-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 105139176 |
| Molecular Formula | C17H16BrNS |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-3-naphthalen-1-ylpropan-2-amine |
| SMILES | NC(Cc1cc(Br)cs1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C17H16BrNS/c18-14-9-16(20-11-14)10-15(19)8-13-6-3-5-12-4-1-2-7-17(12)13/h1-7,9,11,15H,8,10,19H2 |
| InChIKey | UBGBDZCLVRLEPF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |