C13H13Br2NS2 — CID 66143479
1-(2-bromophenyl)sulfanyl-3-(4-bromothiophen-2-yl)propan-2-amine (PubChem CID 66143479) has the molecular formula C13H13Br2NS2 and a molecular weight of 407.20 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfanyl-3-(4-bromothiophen-2-yl)propan-2-amine.
| Compound Name | 1-(2-bromophenyl)sulfanyl-3-(4-bromothiophen-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 66143479 |
| Molecular Formula | C13H13Br2NS2 |
| Molecular Weight | 407.20 g/mol |
| Exact Mass | 404.89 |
| IUPAC Name | 1-(2-bromophenyl)sulfanyl-3-(4-bromothiophen-2-yl)propan-2-amine |
| SMILES | NC(CSc1ccccc1Br)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C13H13Br2NS2/c14-9-5-11(17-7-9)6-10(16)8-18-13-4-2-1-3-12(13)15/h1-5,7,10H,6,8,16H2 |
| InChIKey | VDDHXYNGEBZTOV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.20 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |