C12H10Br3NS — CID 80532924
2-(4-bromophenyl)-1-(4,5-dibromothiophen-2-yl)ethanamine (PubChem CID 80532924) has the molecular formula C12H10Br3NS and a molecular weight of 440.00 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(4,5-dibromothiophen-2-yl)ethanamine.
| Compound Name | 2-(4-bromophenyl)-1-(4,5-dibromothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 80532924 |
| Molecular Formula | C12H10Br3NS |
| Molecular Weight | 440.00 g/mol |
| Exact Mass | 436.81 |
| IUPAC Name | 2-(4-bromophenyl)-1-(4,5-dibromothiophen-2-yl)ethanamine |
| SMILES | NC(Cc1ccc(Br)cc1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H10Br3NS/c13-8-3-1-7(2-4-8)5-10(16)11-6-9(14)12(15)17-11/h1-4,6,10H,5,16H2 |
| InChIKey | VKOFLBUKVSKWPS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.00 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |