C12H8Br4S — CID 80534268
2,3-dibromo-5-[1-bromo-2-(4-bromophenyl)ethyl]thiophene (PubChem CID 80534268) has the molecular formula C12H8Br4S and a molecular weight of 503.88 g/mol. Its IUPAC name is 2,3-dibromo-5-[1-bromo-2-(4-bromophenyl)ethyl]thiophene.
| Compound Name | 2,3-dibromo-5-[1-bromo-2-(4-bromophenyl)ethyl]thiophene |
|---|---|
| PubChem CID | 80534268 |
| Molecular Formula | C12H8Br4S |
| Molecular Weight | 503.88 g/mol |
| Exact Mass | 499.71 |
| IUPAC Name | 2,3-dibromo-5-[1-bromo-2-(4-bromophenyl)ethyl]thiophene |
| SMILES | Brc1ccc(CC(Br)c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C12H8Br4S/c13-8-3-1-7(2-4-8)5-9(14)11-6-10(15)12(16)17-11/h1-4,6,9H,5H2 |
| InChIKey | UTUFWRVBPQVVKY-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.88 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|