C14H13Br3OS — CID 80534563
2,3-dibromo-5-[1-bromo-3-(4-methoxyphenyl)propyl]thiophene (PubChem CID 80534563) has the molecular formula C14H13Br3OS and a molecular weight of 469.04 g/mol. Its IUPAC name is 2,3-dibromo-5-[1-bromo-3-(4-methoxyphenyl)propyl]thiophene.
| Compound Name | 2,3-dibromo-5-[1-bromo-3-(4-methoxyphenyl)propyl]thiophene |
|---|---|
| PubChem CID | 80534563 |
| Molecular Formula | C14H13Br3OS |
| Molecular Weight | 469.04 g/mol |
| Exact Mass | 465.82 |
| IUPAC Name | 2,3-dibromo-5-[1-bromo-3-(4-methoxyphenyl)propyl]thiophene |
| SMILES | COc1ccc(CCC(Br)c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C14H13Br3OS/c1-18-10-5-2-9(3-6-10)4-7-11(15)13-8-12(16)14(17)19-13/h2-3,5-6,8,11H,4,7H2,1H3 |
| InChIKey | PGWVANVVASLQHI-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.04 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|