C18H21BrO2 — CID 63438363
1-[1-bromo-3-(4-methoxyphenyl)propyl]-4-methoxy-2-methylbenzene (PubChem CID 63438363) has the molecular formula C18H21BrO2 and a molecular weight of 349.27 g/mol. Its IUPAC name is 1-[1-bromo-3-(4-methoxyphenyl)propyl]-4-methoxy-2-methylbenzene.
| Compound Name | 1-[1-bromo-3-(4-methoxyphenyl)propyl]-4-methoxy-2-methylbenzene |
|---|---|
| PubChem CID | 63438363 |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-[1-bromo-3-(4-methoxyphenyl)propyl]-4-methoxy-2-methylbenzene |
| SMILES | COc1ccc(CCC(Br)c2ccc(OC)cc2C)cc1 |
| InChI | InChI=1S/C18H21BrO2/c1-13-12-16(21-3)9-10-17(13)18(19)11-6-14-4-7-15(20-2)8-5-14/h4-5,7-10,12,18H,6,11H2,1-3H3 |
| InChIKey | RDMAASWWKPKERE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|