C13H11Br2ClO2S — CID 80534556
2,3-dibromo-5-[chloro-(2,5-dimethoxyphenyl)methyl]thiophene (PubChem CID 80534556) has the molecular formula C13H11Br2ClO2S and a molecular weight of 426.56 g/mol. Its IUPAC name is 2,3-dibromo-5-[chloro-(2,5-dimethoxyphenyl)methyl]thiophene.
| Compound Name | 2,3-dibromo-5-[chloro-(2,5-dimethoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 80534556 |
| Molecular Formula | C13H11Br2ClO2S |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 423.85 |
| IUPAC Name | 2,3-dibromo-5-[chloro-(2,5-dimethoxyphenyl)methyl]thiophene |
| SMILES | COc1ccc(OC)c(C(Cl)c2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C13H11Br2ClO2S/c1-17-7-3-4-10(18-2)8(5-7)12(16)11-6-9(14)13(15)19-11/h3-6,12H,1-2H3 |
| InChIKey | ZKYQPYYNAWLOHJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|