C12H7Br3Cl2OS — CID 80538927
2,3-dibromo-5-[(3-bromo-5-chloro-2-methoxyphenyl)-chloromethyl]thiophene (PubChem CID 80538927) has the molecular formula C12H7Br3Cl2OS and a molecular weight of 509.87 g/mol. Its IUPAC name is 2,3-dibromo-5-[(3-bromo-5-chloro-2-methoxyphenyl)-chloromethyl]thiophene.
| Compound Name | 2,3-dibromo-5-[(3-bromo-5-chloro-2-methoxyphenyl)-chloromethyl]thiophene |
|---|---|
| PubChem CID | 80538927 |
| Molecular Formula | C12H7Br3Cl2OS |
| Molecular Weight | 509.87 g/mol |
| Exact Mass | 505.71 |
| IUPAC Name | 2,3-dibromo-5-[(3-bromo-5-chloro-2-methoxyphenyl)-chloromethyl]thiophene |
| SMILES | COc1c(Br)cc(Cl)cc1C(Cl)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H7Br3Cl2OS/c1-18-11-6(2-5(16)3-7(11)13)10(17)9-4-8(14)12(15)19-9/h2-4,10H,1H3 |
| InChIKey | RBJYJTFDONNWFD-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.87 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|