C14H8BrCl2F3O — CID 65100734
1-bromo-5-chloro-3-[chloro-(2,4,6-trifluorophenyl)methyl]-2-methoxybenzene (PubChem CID 65100734) has the molecular formula C14H8BrCl2F3O and a molecular weight of 400.02 g/mol. Its IUPAC name is 1-bromo-5-chloro-3-[chloro-(2,4,6-trifluorophenyl)methyl]-2-methoxybenzene.
| Compound Name | 1-bromo-5-chloro-3-[chloro-(2,4,6-trifluorophenyl)methyl]-2-methoxybenzene |
|---|---|
| PubChem CID | 65100734 |
| Molecular Formula | C14H8BrCl2F3O |
| Molecular Weight | 400.02 g/mol |
| Exact Mass | 397.91 |
| IUPAC Name | 1-bromo-5-chloro-3-[chloro-(2,4,6-trifluorophenyl)methyl]-2-methoxybenzene |
| SMILES | COc1c(Br)cc(Cl)cc1C(Cl)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H8BrCl2F3O/c1-21-14-8(2-6(16)3-9(14)15)13(17)12-10(19)4-7(18)5-11(12)20/h2-5,13H,1H3 |
| InChIKey | IDKNGZLKIQHLHI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.02 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|