C10H6BrCl2F5O — CID 63431153
1-bromo-5-chloro-3-(1-chloro-2,2,3,3,3-pentafluoropropyl)-2-methoxybenzene (PubChem CID 63431153) has the molecular formula C10H6BrCl2F5O and a molecular weight of 387.96 g/mol. Its IUPAC name is 1-bromo-5-chloro-3-(1-chloro-2,2,3,3,3-pentafluoropropyl)-2-methoxybenzene.
| Compound Name | 1-bromo-5-chloro-3-(1-chloro-2,2,3,3,3-pentafluoropropyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 63431153 |
| Molecular Formula | C10H6BrCl2F5O |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 385.89 |
| IUPAC Name | 1-bromo-5-chloro-3-(1-chloro-2,2,3,3,3-pentafluoropropyl)-2-methoxybenzene |
| SMILES | COc1c(Br)cc(Cl)cc1C(Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6BrCl2F5O/c1-19-7-5(2-4(12)3-6(7)11)8(13)9(14,15)10(16,17)18/h2-3,8H,1H3 |
| InChIKey | DPDUIBLVPXDGAE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|