C12H7Br2ClF2OS — CID 80538886
2,3-dibromo-5-[chloro-(2,6-difluoro-4-methoxyphenyl)methyl]thiophene (PubChem CID 80538886) has the molecular formula C12H7Br2ClF2OS and a molecular weight of 432.51 g/mol. Its IUPAC name is 2,3-dibromo-5-[chloro-(2,6-difluoro-4-methoxyphenyl)methyl]thiophene.
| Compound Name | 2,3-dibromo-5-[chloro-(2,6-difluoro-4-methoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 80538886 |
| Molecular Formula | C12H7Br2ClF2OS |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 429.82 |
| IUPAC Name | 2,3-dibromo-5-[chloro-(2,6-difluoro-4-methoxyphenyl)methyl]thiophene |
| SMILES | COc1cc(F)c(C(Cl)c2cc(Br)c(Br)s2)c(F)c1 |
| InChI | InChI=1S/C12H7Br2ClF2OS/c1-18-5-2-7(16)10(8(17)3-5)11(15)9-4-6(13)12(14)19-9/h2-4,11H,1H3 |
| InChIKey | GGWKGQGWTYYXFT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|