C13H13BrClNO2S — CID 80530686
(5-bromo-4-chlorothiophen-2-yl)-(2,5-dimethoxyphenyl)methanamine (PubChem CID 80530686) has the molecular formula C13H13BrClNO2S and a molecular weight of 362.68 g/mol. Its IUPAC name is (5-bromo-4-chlorothiophen-2-yl)-(2,5-dimethoxyphenyl)methanamine.
| Compound Name | (5-bromo-4-chlorothiophen-2-yl)-(2,5-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 80530686 |
| Molecular Formula | C13H13BrClNO2S |
| Molecular Weight | 362.68 g/mol |
| Exact Mass | 360.95 |
| IUPAC Name | (5-bromo-4-chlorothiophen-2-yl)-(2,5-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(OC)c(C(N)c2cc(Cl)c(Br)s2)c1 |
| InChI | InChI=1S/C13H13BrClNO2S/c1-17-7-3-4-10(18-2)8(5-7)12(16)11-6-9(15)13(14)19-11/h3-6,12H,16H2,1-2H3 |
| InChIKey | QHVAOMOAXSRIKD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |