C15H16ClNO2 — CID 43197194
(2-chlorophenyl)-(2,5-dimethoxyphenyl)methanamine (PubChem CID 43197194) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is (2-chlorophenyl)-(2,5-dimethoxyphenyl)methanamine.
| Compound Name | (2-chlorophenyl)-(2,5-dimethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 43197194 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (2-chlorophenyl)-(2,5-dimethoxyphenyl)methanamine |
| SMILES | COc1ccc(OC)c(C(N)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C15H16ClNO2/c1-18-10-7-8-14(19-2)12(9-10)15(17)11-5-3-4-6-13(11)16/h3-9,15H,17H2,1-2H3 |
| InChIKey | KANCJFOSTDSJPE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |