C16H16BrClO2 — CID 63437142
2-[1-bromo-2-(2-chlorophenyl)ethyl]-1,4-dimethoxybenzene (PubChem CID 63437142) has the molecular formula C16H16BrClO2 and a molecular weight of 355.66 g/mol. Its IUPAC name is 2-[1-bromo-2-(2-chlorophenyl)ethyl]-1,4-dimethoxybenzene.
| Compound Name | 2-[1-bromo-2-(2-chlorophenyl)ethyl]-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 63437142 |
| Molecular Formula | C16H16BrClO2 |
| Molecular Weight | 355.66 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 2-[1-bromo-2-(2-chlorophenyl)ethyl]-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(C(Br)Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C16H16BrClO2/c1-19-12-7-8-16(20-2)13(10-12)14(17)9-11-5-3-4-6-15(11)18/h3-8,10,14H,9H2,1-2H3 |
| InChIKey | AVVCFCYULXJMOP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|