C14H12ClF2NO — CID 54880557
(2-chlorophenyl)-(2,6-difluoro-4-methoxyphenyl)methanamine (PubChem CID 54880557) has the molecular formula C14H12ClF2NO and a molecular weight of 283.71 g/mol. Its IUPAC name is (2-chlorophenyl)-(2,6-difluoro-4-methoxyphenyl)methanamine.
| Compound Name | (2-chlorophenyl)-(2,6-difluoro-4-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 54880557 |
| Molecular Formula | C14H12ClF2NO |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (2-chlorophenyl)-(2,6-difluoro-4-methoxyphenyl)methanamine |
| SMILES | COc1cc(F)c(C(N)c2ccccc2Cl)c(F)c1 |
| InChI | InChI=1S/C14H12ClF2NO/c1-19-8-6-11(16)13(12(17)7-8)14(18)9-4-2-3-5-10(9)15/h2-7,14H,18H2,1H3 |
| InChIKey | DUNWDPONZZCJDS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |