C25H27ClO6 — CID 46896091
2-[(2-chlorophenyl)-(2,4,6-trimethoxyphenyl)methyl]-1,3,5-trimethoxybenzene (PubChem CID 46896091) has the molecular formula C25H27ClO6 and a molecular weight of 458.94 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)-(2,4,6-trimethoxyphenyl)methyl]-1,3,5-trimethoxybenzene.
| Compound Name | 2-[(2-chlorophenyl)-(2,4,6-trimethoxyphenyl)methyl]-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 46896091 |
| Molecular Formula | C25H27ClO6 |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 2-[(2-chlorophenyl)-(2,4,6-trimethoxyphenyl)methyl]-1,3,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(C(c2ccccc2Cl)c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C25H27ClO6/c1-27-15-11-19(29-3)24(20(12-15)30-4)23(17-9-7-8-10-18(17)26)25-21(31-5)13-16(28-2)14-22(25)32-6/h7-14,23H,1-6H3 |
| InChIKey | PDAZSXFPGCAPNX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|