C28H34O7 — CID 91355849
2-[bis(2,4-dimethoxy-6-methylphenyl)methyl]-1,3,5-trimethoxybenzene (PubChem CID 91355849) has the molecular formula C28H34O7 and a molecular weight of 482.57 g/mol. Its IUPAC name is 2-[bis(2,4-dimethoxy-6-methylphenyl)methyl]-1,3,5-trimethoxybenzene.
| Compound Name | 2-[bis(2,4-dimethoxy-6-methylphenyl)methyl]-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 91355849 |
| Molecular Formula | C28H34O7 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 2-[bis(2,4-dimethoxy-6-methylphenyl)methyl]-1,3,5-trimethoxybenzene |
| SMILES | COc1cc(C)c(C(c2c(C)cc(OC)cc2OC)c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C28H34O7/c1-16-10-18(29-3)12-21(32-6)25(16)28(26-17(2)11-19(30-4)13-22(26)33-7)27-23(34-8)14-20(31-5)15-24(27)35-9/h10-15,28H,1-9H3 |
| InChIKey | FVDLDYAWWSDJBQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|