C12H18ClNO2 — CID 116937769
3-chloro-1-(2,4-dimethoxy-6-methylphenyl)propan-1-amine (PubChem CID 116937769) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 3-chloro-1-(2,4-dimethoxy-6-methylphenyl)propan-1-amine.
| Compound Name | 3-chloro-1-(2,4-dimethoxy-6-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 116937769 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-chloro-1-(2,4-dimethoxy-6-methylphenyl)propan-1-amine |
| SMILES | COc1cc(C)c(C(N)CCCl)c(OC)c1 |
| InChI | InChI=1S/C12H18ClNO2/c1-8-6-9(15-2)7-11(16-3)12(8)10(14)4-5-13/h6-7,10H,4-5,14H2,1-3H3 |
| InChIKey | CXBBNKVBOYZBNY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|